On Target CNR1_HUMAN 0.5877193/CHEMBL260284
For the given ligand YJING, we have found in our database that, being scored 0.5877193, the most similar ligand is CHEMBL260284. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL260284 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | O=C(N1CCOCC1)c2ccc3OC(Oc3c2)(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04000008 44004808 20000109 80210600 00001080 00004000 02040000 03001000 00200100 00080840 48200000 40008000 0080c802 20010080 01005409 22288108 10000000 02000000 00480000 00020200 00040200 08028620 12000000 00c4901c 40000400 e0002000 00a20000 e0000001 01000380 00060003 c0040000 00010600 |