On Target PLP_SARS 0.23364486/CHEMBL222893
For the given ligand Canagliflozin, we have found in our database that, being scored 0.23364486, the most similar ligand is CHEMBL222893. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL222893 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1 |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 04018042 15000808 60004108 20010200 000c1040 04004084 80080080 01200000 00000100 00000840 00000204 40058880 0680881c 08010002 01032082 060c000c 09030000 02002008 00200008 00020010 40002060 48028ba8 30900080 10c09004 02002c02 84082200 00000200 80000004 00000200 00020000 c0000000 10c30400 |