On Target NSP15_SARS 0.21860465/CHEMBL2441745
For the given ligand Canagliflozin, we have found in our database that, being scored 0.21860465, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |