On Target NS3_HCV1A 0.04255319/CHEMBL4109867
For the given ligand Metformin, we have found in our database that, being scored 0.04255319, the most similar ligand is CHEMBL4109867. Check out the elaboration below.
| Metformin (Given Ligand) | CHEMBL4109867 (Similar Ligand) |
|---|---|
| CN(C)C(=N)NC(=N)N | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(C=N)cc2)c1F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 00000000 00000000 00000000 00002000 00000000 00000002 00200000 00000002 00000000 00000000 00000000 00200000 00000000 00000000 00000000 00000000 00000100 00020000 00000000 00000000 00000000 00000000 40000000 20000000 00000010 00040000 00000001 00000000 | 00008040 00000800 00100100 42010600 00000201 00000010 20000000 01001000 00000900 00080e41 08100000 40008a00 02008864 00001004 00000000 08080008 03000200 03000000 00000400 00000001 00000500 18028300 01000000 10400014 00002000 a0000200 48040000 40800081 00000088 00068002 c4040000 00020600 |