On Target NP_HCoV-OC43 0.21818182/CHEMBL3233481
For the given ligand Repaglinide, we have found in our database that, being scored 0.21818182, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Repaglinide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCOc3cc(CC(=O)N[C@@H](CC(C)C)c1ccccc1N2CCCCC2)ccc3C(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04004002 43801808 2010010a 40050600 20001000 80126040 03000000 22001800 00000980 200808c0 08300004 50019820 03808802 20200080 41020541 0008200a 00048000 03008002 08080008 00820201 c0100100 18268e20 20000000 8150001c 00000000 c0000000 00000800 90011080 04088300 00060003 e0046080 60002600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |