On Target NS5B_HCV1B 0.3266129/CHEMBL3645180
For the given ligand Rosiglitazone, we have found in our database that, being scored 0.3266129, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Rosiglitazone (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| CN(CCOc2ccc(CC1SC(=O)NC1=O)cc2)c3ccccn3 | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04006002 00001328 20107308 00110606 00051080 00000800 02040000 00000000 00400800 230948c1 08340005 40009300 0481b802 000c0000 01001001 000c000c 04040410 02004200 08200008 00a20101 40120108 1c048604 32800900 02600018 00000800 80000020 08120080 140000c0 00008208 0006081b 00005010 83010600 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |