On Target PA_INFA 0.33333334/CHEMBL463590
For the given ligand Repaglinide, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| Repaglinide (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| CCOc3cc(CC(=O)N[C@@H](CC(C)C)c1ccccc1N2CCCCC2)ccc3C(=O)O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 04004002 43801808 2010010a 40050600 20001000 80126040 03000000 22001800 00000980 200808c0 08300004 50019820 03808802 20200080 41020541 0008200a 00048000 03008002 08080008 00820201 c0100100 18268e20 20000000 8150001c 00000000 c0000000 00000800 90011080 04088300 00060003 e0046080 60002600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |