On Target PLP_SARS 0.21546961/CHEMBL212454
For the given ligand Fedratinib, we have found in our database that, being scored 0.21546961, the most similar ligand is CHEMBL212454. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL212454 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(Cl)=C(Cl)Cl)cc2)cc1)C(Cl)=C(Cl)Cl |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 04080000 00804228 20020008 20900200 02041000 00000080 02040080 00000400 01000000 00000840 00002000 60008000 02808002 00000100 81610001 00080008 04021000 02000000 00200410 00022000 80002000 08000b80 10800000 08000009 00000040 08000000 00800000 00000080 00000204 00020000 04000000 10030030 |