On Target RT_HIV1 0.3478261/CHEMBL4225865
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/C(OC(CC)CC)C(NC(C)=O)C(N)C1 | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |