On Target RT_HIV1 0.4591195/CHEMBL4225004
For the given ligand Glimepiride, we have found in our database that, being scored 0.4591195, the most similar ligand is CHEMBL4225004. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL4225004 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@H]1CC[C@H](C)CC1)cc2)C3=O | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccc(S(N)(=O)=O)cc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00000010 01801800 01100302 40b50600 00000008 00004000 80000080 20000402 00000980 001808c0 08302000 60018800 00028002 00200001 80200402 00080008 00000400 02000020 02012000 00002201 81000100 18260a30 00008020 8950001c 01200000 80000000 00406000 d0000028 04400002 21060002 e4020000 00012620 |