On Target NS3_HCV1B 0.35815603/CHEMBL3954962
For the given ligand Bictegravir, we have found in our database that, being scored 0.35815603, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Bictegravir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| O=C(NCc1c(F)cc(F)cc1F)c5cn4C[C@H]3O[C@@H]2CC[C@@H](C2)N3C(=O)c4c(O)c5=O | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 10000082 45c0fc08 60104100 d2010f90 041c102a 08128154 1c024000 a2203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02a26200 82084106 00e00802 00160201 c0000021 383f8e50 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004a00 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |