On Target NS3_HCV1A 0.37412587/CHEMBL3645743
For the given ligand Bictegravir, we have found in our database that, being scored 0.37412587, the most similar ligand is CHEMBL3645743. Check out the elaboration below.
| Bictegravir (Given Ligand) | CHEMBL3645743 (Similar Ligand) |
|---|---|
| O=C(NCc1c(F)cc(F)cc1F)c5cn4C[C@H]3O[C@@H]2CC[C@@H](C2)N3C(=O)c4c(O)c5=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cc3cc(OC)ccc3[nH]1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 10000082 45c0fc08 60104100 d2010f90 041c102a 08128154 1c024000 a2203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02a26200 82084106 00e00802 00160201 c0000021 383f8e50 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004a00 | 000180a2 0900b808 26100108 15210e00 00041020 00100010 060a0000 22003409 10000000 0011c9c8 00692004 4001b000 0601881e 01502011 a1420441 0204010c 04004000 02000006 46212000 00024201 40000000 38078638 20802003 b2d0003c 00102000 c0000000 00000000 90000010 08000304 c0060081 e4064204 00016260 |