On Target NSP15_SARS 0.1904762/CHEMBL2441741
For the given ligand Test1, we have found in our database that, being scored 0.1904762, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |