On Target PA_INFA 0.40206185/CHEMBL3600947
For the given ligand Test1, we have found in our database that, being scored 0.40206185, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |