On Target PLP_SARS 0.1952381/CHEMBL212218
For the given ligand emtricitabine, we have found in our database that, being scored 0.1952381, the most similar ligand is CHEMBL212218. Check out the elaboration below.
| emtricitabine (Given Ligand) | CHEMBL212218 (Similar Ligand) |
|---|---|
| Nc2nc(=O)n([C@@H]1CS[C@H](CO)O1)cc2F | Cc1cc(S(=O)(=O)c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)cc1Cl |
|
|
|
|
|
|
| 00000002 40400000 20140001 8c180640 04080040 000060a0 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc1010 05a25080 001c100c 04240406 10204000 00402000 00201000 80080000 18000000 25800241 08600800 80030400 40000012 00000200 90003862 00000209 01460000 c0281000 060102c0 | 00008002 00c01210 00120100 00910200 00040100 08010020 00000400 10000000 14000000 00004870 04002004 60008804 02010005 01010400 a03001c0 00000010 04041100 02004000 00200000 00002140 c0022004 0c604100 20800820 08480c09 000c6000 c0080200 10244010 b0006020 00c00200 01060200 00120000 04030220 |