On Target NA_INFB 0.16751269/CHEMBL195288
For the given ligand emtricitabine, we have found in our database that, being scored 0.16751269, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| emtricitabine (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| Nc2nc(=O)n([C@@H]1CS[C@H](CO)O1)cc2F | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 00000002 40400000 20140001 8c180640 04080040 000060a0 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc1010 05a25080 001c100c 04240406 10204000 00402000 00201000 80080000 18000000 25800241 08600800 80030400 40000012 00000200 90003862 00000209 01460000 c0281000 060102c0 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |