On Target NA_INFB 0.3838384/CHEMBL79499
For the given ligand Moexipril, we have found in our database that, being scored 0.3838384, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N3Cc2cc(OC)c(OC)cc2CC3C(=O)O | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |