On Target PLP_SARS 0.2919708/CHEMBL222735
For the given ligand Tilorone, we have found in our database that, being scored 0.2919708, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |