On Target NSP15_SARS 0.21118012/CHEMBL2441741
For the given ligand Tilorone, we have found in our database that, being scored 0.21118012, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |