On Target NS5B_HCV1A 0.296875/CHEMBL175894
For the given ligand Tilorone, we have found in our database that, being scored 0.296875, the most similar ligand is CHEMBL175894. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL175894 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | N#Cc1ccc(Br)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 00056000 01008801 00000102 00010200 00080021 00000000 00000000 00000000 54100900 00880840 08100008 c001d000 04008010 00200000 20000000 08082008 00420000 02001000 04c00008 00008001 00000100 08020a00 11000480 00400014 00000800 80000080 00120000 00000041 10004002 00060402 80000008 08400400 |