On Target RT_HIV1 0.46583852/CHEMBL4227326
For the given ligand Mefloquine, we have found in our database that, being scored 0.46583852, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| Mefloquine (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C3CCCCN3 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000002 01050800 00104102 50050610 000c10a0 0000c000 00004c00 20000000 00400980 000808f0 0c300004 50018802 98000802 01e08000 001a0040 020c000c 10000020 02000000 00602000 40000201 40000100 18208038 23800000 81400010 00042002 c0000000 08000140 90000010 04000006 00060002 40160000 00002620 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |