On Target PR_HIV1 0.26486486/CHEMBL450294
For the given ligand Tilorone, we have found in our database that, being scored 0.26486486, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |