On Target PR_HIV1 0.21022727/CHEMBL492666
For the given ligand Cyclosporine, we have found in our database that, being scored 0.21022727, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Cyclosporine (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00010000 81007000 00100000 04000400 00000080 00000000 00000000 20000408 00000000 00100080 00200000 40013000 1602800a 00002001 80180400 00080008 10000000 00000000 00c12000 00002201 00000000 30040610 03008083 02100018 00000001 00000000 00404000 90000000 08000000 00040001 24004000 00002200 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |