On Target NS3_HCV1A 0.2535211/CHEMBL3645746
For the given ligand Hydroxyprogesterone caproate, we have found in our database that, being scored 0.2535211, the most similar ligand is CHEMBL3645746. Check out the elaboration below.
| Hydroxyprogesterone caproate (Given Ligand) | CHEMBL3645746 (Similar Ligand) |
|---|---|
| CCCCCC(=O)O[C@]4(C(C)=O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2CC[C@@]34C | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC1CCCCO1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00010040 01000000 00000100 00010300 00080000 00000000 00000080 00000402 01000000 00108000 00000000 4000d000 04028008 00800000 00000400 08081008 00820000 80000020 02412000 00000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 01000002 24020000 02000000 | 000100e0 09003000 06100100 05210500 800c0000 00200010 000a0000 20001408 10000000 0010c188 00602000 4001b000 1601801a 01882011 a0400400 00081008 04204000 00000000 46c12000 00004201 00000020 30040630 01000083 32900038 00000401 00000000 00000000 90000010 08000200 c0040081 64024004 00012260 |