On Target NP_HCoV-OC43 0.058441557/CHEMBL3233481
For the given ligand Salinomycin, we have found in our database that, being scored 0.058441557, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Salinomycin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCC(C(=O)O)C5CCC(C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]4O[C@]3(/C=C\[C@@H](O)[C@]2(CC[C@@](C)([C@H]1CC[C@](O)(CC)[C@H](C)O1)O2)O3)[C@H](C)C[C@@H]4C)O5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00050040 01000000 00000800 00810100 803c0140 00a00800 02002800 28000442 00202000 011000a0 40000200 40019001 1c028028 02800000 00080404 002a9008 00800000 00000000 3140a010 00008001 20100020 00001a10 0500a000 08100010 00201400 00001400 00404002 a4000020 00000200 00000000 24220000 00000010 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |