On Target NS5B_HCV1B 0.1724138/CHEMBL3645211
For the given ligand Salinomycin, we have found in our database that, being scored 0.1724138, the most similar ligand is CHEMBL3645211. Check out the elaboration below.
| Salinomycin (Given Ligand) | CHEMBL3645211 (Similar Ligand) |
|---|---|
| CCC(C(=O)O)C5CCC(C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]4O[C@]3(/C=C\[C@@H](O)[C@]2(CC[C@@](C)([C@H]1CC[C@](O)(CC)[C@H](C)O1)O2)O3)[C@H](C)C[C@@H]4C)O5 | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00050040 01000000 00000800 00810100 803c0140 00a00800 02002800 28000442 00202000 011000a0 40000200 40019001 1c028028 02800000 00080404 002a9008 00800000 00000000 3140a010 00008001 20100020 00001a10 0500a000 08100010 00201400 00001400 00404002 a4000020 00000200 00000000 24220000 00000010 | 00004006 0480de08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 80008c33 01400201 804a0040 002e300e 04268000 02000004 09608008 00224201 c0100121 1c838e38 2180c800 9360001c 02104480 c0000040 00270280 b400108c 0c488304 0046004b c4248088 a8114ff0 |