On Target PR_HIV1 0.23502304/CHEMBL492666
For the given ligand Cepharanthine, we have found in our database that, being scored 0.23502304, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |