On Target NS5B_HCV1B 0.27731094/CHEMBL3645180
For the given ligand Berbamine, we have found in our database that, being scored 0.27731094, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Berbamine (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| COc4cc5CCN(C)C6Cc1ccc(cc1)Oc2cc(ccc2O)CC7c3c(cc(OC)c(OC)c3Oc4cc56)CCN7C | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000009 46000008 20100108 10018600 00001020 c0000102 42040000 02401601 00100884 00180840 08300000 40808840 00004882 20200000 01000401 0000a008 40000200 02000024 00082000 00020a01 00420100 18308100 00404000 81448410 00000000 e8000001 00320000 80200000 04000380 0006000a 24060400 00002700 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |