On Target NS5B_HCV1B 0.33881578/CHEMBL3645214
For the given ligand Gilteritinib, we have found in our database that, being scored 0.33881578, the most similar ligand is CHEMBL3645214. Check out the elaboration below.
| Gilteritinib (Given Ligand) | CHEMBL3645214 (Similar Ligand) |
|---|---|
| CCc4nc(C(N)=O)c(Nc3ccc(N2CCC(N1CCN(C)CC1)CC2)c(OC)c3)nc4NC5CCOCC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCOC3)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0000400a 81811409 20100d88 15810730 ae081040 08012052 1200e010 001010c1 10c02100 200809e0 01298024 5003e010 00008002 08182000 01820941 000c400e 08248000 12005000 08c08402 10a22641 e0180020 78048600 210048a1 02108018 00140402 01100000 28000410 100110cc 0808820c 006e1811 c0001400 e0020280 | 00044006 00805e08 20180902 43390f00 211c0000 00204052 02040010 2200140c 00102900 004909e0 09312024 40119800 94008c23 01481201 808a0040 000e200e 04268000 02000104 08e0000a 00225203 e0100121 1c8f8e38 21800880 9360001c 02104481 c0000048 02270280 9000108d 0c488304 0046805b c4048080 a0116fe0 |