On Target PR_HIV1 0.26568267/CHEMBL503401
For the given ligand Gilteritinib, we have found in our database that, being scored 0.26568267, the most similar ligand is CHEMBL503401. Check out the elaboration below.
| Gilteritinib (Given Ligand) | CHEMBL503401 (Similar Ligand) |
|---|---|
| CCc4nc(C(N)=O)c(Nc3ccc(N2CCC(N1CCN(C)CC1)CC2)c(OC)c3)nc4NC5CCOCC5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCOCCOC2)cc1 |
|
|
|
|
|
|
| 0000400a 81811409 20100d88 15810730 ae081040 08012052 1200e010 001010c1 10c02100 200809e0 01298024 5003e010 00008002 08182000 01820941 000c400e 08248000 12005000 08c08402 10a22641 e0180020 78048600 210048a1 02108018 00140402 01100000 28000410 100110cc 0808820c 006e1811 c0001400 e0020280 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02002000 28000044 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a8008 10022000 02080000 01400800 01027603 80100120 18280c90 07100040 d9500058 02000400 8000000e 00800000 342000ec 04000600 20060013 80000000 00012670 |