On Target PA_INFA 0.29746836/CHEMBL463590
For the given ligand Tetrandrine, we have found in our database that, being scored 0.29746836, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| Tetrandrine (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| COc1ccc3cc1Oc2ccc(cc2)C[C@H]7c6cc(Oc5c(OC)c(OC)cc4CCN(C)[C@@H](C3)c45)c(OC)cc6CCN7C | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00000009 46000008 20100108 10018600 00001020 c0000102 42040000 02401601 00100884 00180840 08300000 40808840 00004882 20200000 01000401 0000a008 40000200 02000024 00082000 00020a01 00420100 18308100 00404000 81448410 00000000 e8000001 00320000 80200000 04000380 0006000a 24060400 00002700 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |