On Target NS3_HCV1A 0.3621795/CHEMBL3891364
For the given ligand Gilteritinib, we have found in our database that, being scored 0.3621795, the most similar ligand is CHEMBL3891364. Check out the elaboration below.
| Gilteritinib (Given Ligand) | CHEMBL3891364 (Similar Ligand) |
|---|---|
| CCc4nc(C(N)=O)c(Nc3ccc(N2CCC(N1CCN(C)CC1)CC2)c(OC)c3)nc4NC5CCOCC5 | COc1ccc(Sc2ccc(C#Cc3ccc(-c4c[nH]c([C@@H]5CCCN5C(=O)[C@@H](c5ccccc5)N(C)C)n4)cc3)cc2Nc2ncnc3nc(C(C)C)ccc23)cc1 |
|
|
|
|
|
|
| 0000400a 81811409 20100d88 15810730 ae081040 08012052 1200e010 001010c1 10c02100 200809e0 01298024 5003e010 00008002 08182000 01820941 000c400e 08248000 12005000 08c08402 10a22641 e0180020 78048600 210048a1 02108018 00140402 01100000 28000410 100110cc 0808820c 006e1811 c0001400 e0020280 | 1000820a 01825a08 201a4d08 1c190e10 04443060 0010601a 03409010 22083841 10002180 000808d0 08319004 6081b800 07008883 08912000 41020441 9a0c010e 04069000 76006022 0c60040a 52220a11 c1200000 38a78660 21806041 8358001f 00144005 80080200 02a082d8 900010c0 0c41c30c 01e60803 c004e8a0 200126e0 |