On Target PLP_SARS 0.47096774/CHEMBL358279
For the given ligand Ivacaftor, we have found in our database that, being scored 0.47096774, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Ivacaftor (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CC(C)(C)c3cc(C(C)(C)C)c(NC(=O)c2c[nH]c1ccccc1c2=O)cc3O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10004002 8080c808 20004102 40010610 10041003 00000060 02004000 02001200 02000000 40080840 09280024 4000c000 00008802 00708000 00020040 000c200c 00048080 02004004 08200000 00022400 c0100000 08068e08 20812000 8054001c 00040000 80000000 08920010 808c1080 00488100 00060003 c0040000 a0000600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |