On Target PLP_SARS 0.30167598/CHEMBL225515
For the given ligand Bazedoxifene, we have found in our database that, being scored 0.30167598, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Bazedoxifene (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| Cc4c(c1ccc(O)cc1)n(Cc3ccc(OCCN2CCCCCC2)cc3)c5ccc(O)cc45 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 04006002 01000a09 20100108 10010612 200410a0 00000000 06040000 20081000 80100000 100008c0 00200004 40018000 00800836 00608000 210a1041 020c000c 10020000 82802004 04282000 80420203 40100000 18048018 32800000 81500011 00042000 c0000000 08220000 10000041 04004204 00060448 00040a00 00002220 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |