On Target NP_HCoV-OC43 0.35555556/CHEMBL3233481
For the given ligand Ivacaftor, we have found in our database that, being scored 0.35555556, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Ivacaftor (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)(C)c3cc(C(C)(C)C)c(NC(=O)c2c[nH]c1ccccc1c2=O)cc3O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10004002 8080c808 20004102 40010610 10041003 00000060 02004000 02001200 02000000 40080840 09280024 4000c000 00008802 00708000 00020040 000c200c 00048080 02004004 08200000 00022400 c0100000 08068e08 20812000 8054001c 00040000 80000000 08920010 808c1080 00488100 00060003 c0040000 a0000600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |