On Target NP_HCoV-OC43 0.20779221/CHEMBL3233481
For the given ligand Bazedoxifene, we have found in our database that, being scored 0.20779221, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Bazedoxifene (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc4c(c1ccc(O)cc1)n(Cc3ccc(OCCN2CCCCCC2)cc3)c5ccc(O)cc45 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04006002 01000a09 20100108 10010612 200410a0 00000000 06040000 20081000 80100000 100008c0 00200004 40018000 00800836 00608000 210a1041 020c000c 10020000 82802004 04282000 80420203 40100000 18048018 32800000 81500011 00042000 c0000000 08220000 10000041 04004204 00060448 00040a00 00002220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |