On Target NS5B_HCV1A 0.36526945/CHEMBL363650
For the given ligand Bazedoxifene, we have found in our database that, being scored 0.36526945, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| Bazedoxifene (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| Cc4c(c1ccc(O)cc1)n(Cc3ccc(OCCN2CCCCCC2)cc3)c5ccc(O)cc45 | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 04006002 01000a09 20100108 10010612 200410a0 00000000 06040000 20081000 80100000 100008c0 00200004 40018000 00800836 00608000 210a1041 020c000c 10020000 82802004 04282000 80420203 40100000 18048018 32800000 81500011 00042000 c0000000 08220000 10000041 04004204 00060448 00040a00 00002220 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |