On Target PR_HIV1 0.2685185/CHEMBL450294
For the given ligand Bazedoxifene, we have found in our database that, being scored 0.2685185, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Bazedoxifene (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| Cc4c(c1ccc(O)cc1)n(Cc3ccc(OCCN2CCCCCC2)cc3)c5ccc(O)cc45 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 04006002 01000a09 20100108 10010612 200410a0 00000000 06040000 20081000 80100000 100008c0 00200004 40018000 00800836 00608000 210a1041 020c000c 10020000 82802004 04282000 80420203 40100000 18048018 32800000 81500011 00042000 c0000000 08220000 10000041 04004204 00060448 00040a00 00002220 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |