On Target PLP_SARS 0.17419355/CHEMBL358279
For the given ligand Favipiravir, we have found in our database that, being scored 0.17419355, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |