On Target NP_HCoV-OC43 0.15126051/CHEMBL3233481
For the given ligand Favipiravir, we have found in our database that, being scored 0.15126051, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |