On Target NS5B_HCV1B 0.31343284/CHEMBL99408
For the given ligand Enisamium iodide, we have found in our database that, being scored 0.31343284, the most similar ligand is CHEMBL99408. Check out the elaboration below.
| Enisamium iodide (Given Ligand) | CHEMBL99408 (Similar Ligand) |
|---|---|
| C[n+]2ccc(C(=O)NCc1ccccc1)cc2.[I-] | Nc1ccc2ncccc2c1 |
|
|
|
|
|
|
| 00000002 00801800 00004100 00010600 00040000 00000000 00000000 02001004 00000000 000008c0 00200004 40018000 80008802 00000000 00000400 00040004 00002008 02800000 00200000 00000000 c0000000 18048610 20800000 0040000c 00004000 c0000000 00000000 80000000 00000100 00060001 802c8000 00000220 | 00000002 00800000 00004000 00000200 00040000 00000000 00000000 00000000 00000000 00000840 00000004 00008000 00000800 00400000 00000040 00040004 00000000 00000008 00200000 00000000 40000000 08008008 20800000 80000000 00000000 00000000 00000000 00000000 00000000 00060000 00040000 00000000 |