On Target NS5B_HCV1A 0.2962963/CHEMBL353549
For the given ligand Enisamium iodide, we have found in our database that, being scored 0.2962963, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Enisamium iodide (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| C[n+]2ccc(C(=O)NCc1ccccc1)cc2.[I-] | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 00000002 00801800 00004100 00010600 00040000 00000000 00000000 02001004 00000000 000008c0 00200004 40018000 80008802 00000000 00000400 00040004 00002008 02800000 00200000 00000000 c0000000 18048610 20800000 0040000c 00004000 c0000000 00000000 80000000 00000100 00060001 802c8000 00000220 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |