On Target ACE2_HUMAN 0.14444445/CHEMBL429844
For the given ligand Favipiravir, we have found in our database that, being scored 0.14444445, the most similar ligand is CHEMBL429844. Check out the elaboration below.
| Favipiravir (Given Ligand) | CHEMBL429844 (Similar Ligand) |
|---|---|
| NC(=O)c1nc(F)cnc1O | CC(C)C[C@H](N[C@@H](Cc1cncn1Cc1cc(Cl)cc(Cl)c1)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000002 02800018 40100800 14000410 00000040 00020004 0000c002 00401441 10000000 00000000 01090000 40000000 01008000 00103000 40820000 0004200c 08000000 02002000 00000000 00000000 80060000 0040a600 21004000 00000208 00148400 00000000 08000000 10000004 00000004 00060801 80001000 84000200 | 04018002 09800200 00101100 01810610 040800c0 00000020 04002000 20001000 80400980 10090ac0 2020a008 5001b800 06009806 00100c02 812b0080 000c000c 10000000 0e000000 00480018 40010201 80000c00 18208b00 230000c1 93400410 00043001 c0000200 10000000 10000000 04400004 00460008 400c4004 20022600 |