On Target NS3_HCV1A 0.3862069/CHEMBL3645763
For the given ligand Enisamium iodide, we have found in our database that, being scored 0.3862069, the most similar ligand is CHEMBL3645763. Check out the elaboration below.
| Enisamium iodide (Given Ligand) | CHEMBL3645763 (Similar Ligand) |
|---|---|
| C[n+]2ccc(C(=O)NCc1ccccc1)cc2.[I-] | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1ccnc3ccccc13)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000002 00801800 00004100 00010600 00040000 00000000 00000000 02001004 00000000 000008c0 00200004 40018000 80008802 00000000 00000400 00040004 00002008 02800000 00200000 00000000 c0000000 18048610 20800000 0040000c 00004000 c0000000 00000000 80000000 00000100 00060001 802c8000 00000220 | 000180a2 09003800 06104100 05210600 00040000 00000010 000a0000 2200140c 10000000 0011c9c8 00602004 4001b000 8601881a 01402011 a0400440 00040004 04004008 02000000 46212000 00004201 40000000 38068638 20800003 b2d0003c 00004000 c0000000 00000000 90000010 08000100 c0060081 e406c004 00012260 |