On Target RDRP_SARS2 0.24092409/CHEMBL4065616
For the given ligand Mefloquine, we have found in our database that, being scored 0.24092409, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Mefloquine (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C3CCCCN3 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000002 01050800 00104102 50050610 000c10a0 0000c000 00004c00 20000000 00400980 000808f0 0c300004 50018802 98000802 01e08000 001a0040 020c000c 10000020 02000000 00602000 40000201 40000100 18208038 23800000 81400010 00042002 c0000000 08000140 90000010 04000006 00060002 40160000 00002620 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |