On Target RT_HIV1 0.32061067/CHEMBL4225441
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.32061067, the most similar ligand is CHEMBL4225441. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL4225441 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | C=C(C)[C@@H]1CC[C@]2(CN(C)CCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 00000000 45000c00 20100302 48150600 00000000 00004000 80000080 20000402 00020900 021a49e0 08302000 40018800 00028006 00240000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 18020a30 00008260 04580014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 02012620 |