On Target GP_EBOV 0.23312883/CHEMBL3125897
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.23312883, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |