On Target PA_INFA 0.22950819/CHEMBL2040554
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.22950819, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |