On Target PR_HIV1 0.15322581/CHEMBL523528
For the given ligand Imatinib, we have found in our database that, being scored 0.15322581, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |