On Target RT_HIV1 0.22137405/CHEMBL4225753
For the given ligand XRK3, we have found in our database that, being scored 0.22137405, the most similar ligand is CHEMBL4225753. Check out the elaboration below.
| XRK3 (Given Ligand) | CHEMBL4225753 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | C=C(C)[C@@H]1CC[C@]2(CNCCCNCCO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 00000000 01000c00 00100302 40050600 00000080 00004000 80000080 20000402 00000900 001809e0 08300000 40018800 00028002 00200000 00080402 00080008 10000400 02000020 02012000 00000201 01000100 18020a30 02008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |